C9H8N6O3 — CID 11107684
7,9-dimethyl-1H-purino[8,7-c][1,2,4]triazine-4,6,8-trione (PubChem CID 11107684) has the molecular formula C9H8N6O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 7,9-dimethyl-1H-purino[8,7-c][1,2,4]triazine-4,6,8-trione.
| Compound Name | 7,9-dimethyl-1H-purino[8,7-c][1,2,4]triazine-4,6,8-trione |
|---|---|
| PubChem CID | 11107684 |
| Molecular Formula | C9H8N6O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 7,9-dimethyl-1H-purino[8,7-c][1,2,4]triazine-4,6,8-trione |
| SMILES | Cn1c(=O)c2c(nc3[nH]ncc(=O)n32)n(C)c1=O |
| InChI | InChI=1S/C9H8N6O3/c1-13-6-5(7(17)14(2)9(13)18)15-4(16)3-10-12-8(15)11-6/h3H,1-2H3,(H,11,12) |
| InChIKey | IIABSBCCPLFMJF-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |