C11H12N4O2S — CID 121224194
8-ethyl-2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione (PubChem CID 121224194) has the molecular formula C11H12N4O2S and a molecular weight of 264.31 g/mol. Its IUPAC name is 8-ethyl-2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione.
| Compound Name | 8-ethyl-2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione |
|---|---|
| PubChem CID | 121224194 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 8-ethyl-2,4-dimethylpurino[8,7-b][1,3]thiazole-1,3-dione |
| SMILES | CCc1csc2nc3c(c(=O)n(C)c(=O)n3C)n12 |
| InChI | InChI=1S/C11H12N4O2S/c1-4-6-5-18-10-12-8-7(15(6)10)9(16)14(3)11(17)13(8)2/h5H,4H2,1-3H3 |
| InChIKey | NJZWWBCNNWVQKM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |