C15H20N6O2 — CID 16856693
8-(3,5-diethylpyrazol-1-yl)-1,3,7-trimethylpurine-2,6-dione (PubChem CID 16856693) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 8-(3,5-diethylpyrazol-1-yl)-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-(3,5-diethylpyrazol-1-yl)-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 16856693 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 8-(3,5-diethylpyrazol-1-yl)-1,3,7-trimethylpurine-2,6-dione |
| SMILES | CCc1cc(CC)n(-c2nc3c(c(=O)n(C)c(=O)n3C)n2C)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-6-9-8-10(7-2)21(17-9)14-16-12-11(18(14)3)13(22)20(5)15(23)19(12)4/h8H,6-7H2,1-5H3 |
| InChIKey | MBJYILWXLYNWNI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |