C15H20N6O2 — CID 16856662
8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methylpurine-2,6-dione (PubChem CID 16856662) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 16856662 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 8-(3,5-diethylpyrazol-1-yl)-7-ethyl-3-methylpurine-2,6-dione |
| SMILES | CCc1cc(CC)n(-c2nc3c(c(=O)[nH]c(=O)n3C)n2CC)n1 |
| InChI | InChI=1S/C15H20N6O2/c1-5-9-8-10(6-2)21(18-9)14-16-12-11(20(14)7-3)13(22)17-15(23)19(12)4/h8H,5-7H2,1-4H3,(H,17,22,23) |
| InChIKey | NMDGIRPYVICKOC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |