C19H25N7O3 — CID 16857086
2-[8-(3,5-diethylpyrazol-1-yl)-3-methyl-7-(2-methylprop-2-enyl)-2,6-dioxopurin-1-yl]acetamide (PubChem CID 16857086) has the molecular formula C19H25N7O3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[8-(3,5-diethylpyrazol-1-yl)-3-methyl-7-(2-methylprop-2-enyl)-2,6-dioxopurin-1-yl]acetamide.
| Compound Name | 2-[8-(3,5-diethylpyrazol-1-yl)-3-methyl-7-(2-methylprop-2-enyl)-2,6-dioxopurin-1-yl]acetamide |
|---|---|
| PubChem CID | 16857086 |
| Molecular Formula | C19H25N7O3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-[8-(3,5-diethylpyrazol-1-yl)-3-methyl-7-(2-methylprop-2-enyl)-2,6-dioxopurin-1-yl]acetamide |
| SMILES | C=C(C)Cn1c(-n2nc(CC)cc2CC)nc2c1c(=O)n(CC(N)=O)c(=O)n2C |
| InChI | InChI=1S/C19H25N7O3/c1-6-12-8-13(7-2)26(22-12)18-21-16-15(24(18)9-11(3)4)17(28)25(10-14(20)27)19(29)23(16)5/h8H,3,6-7,9-10H2,1-2,4-5H3,(H2,20,27) |
| InChIKey | XWMBJDGUBHRCTJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|