C18H24N6O2 — CID 16855027
8-(3,5-dimethylpyrazol-1-yl)-3-methyl-1-(2-methylprop-2-enyl)-7-propan-2-ylpurine-2,6-dione (PubChem CID 16855027) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 8-(3,5-dimethylpyrazol-1-yl)-3-methyl-1-(2-methylprop-2-enyl)-7-propan-2-ylpurine-2,6-dione.
| Compound Name | 8-(3,5-dimethylpyrazol-1-yl)-3-methyl-1-(2-methylprop-2-enyl)-7-propan-2-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 16855027 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 8-(3,5-dimethylpyrazol-1-yl)-3-methyl-1-(2-methylprop-2-enyl)-7-propan-2-ylpurine-2,6-dione |
| SMILES | C=C(C)Cn1c(=O)c2c(nc(-n3nc(C)cc3C)n2C(C)C)n(C)c1=O |
| InChI | InChI=1S/C18H24N6O2/c1-10(2)9-22-16(25)14-15(21(7)18(22)26)19-17(23(14)11(3)4)24-13(6)8-12(5)20-24/h8,11H,1,9H2,2-7H3 |
| InChIKey | PDXPACUOZMDWPC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|