About 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one
2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one (PubChem CID 71786184) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 71786184 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one |
| SMILES | Cn1c(=O)c(NN)nc2cccnc21 |
| InChI | InChI=1S/C8H9N5O/c1-13-7-5(3-2-4-10-7)11-6(12-9)8(13)14/h2-4H,9H2,1H3,(H,11,12) |
| InChIKey | SPTWUGGMSRURCM-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one (CID 71786184) is 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one is Cn1c(=O)c(NN)nc2cccnc21.
What is the InChIKey of 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one?
The InChIKey is SPTWUGGMSRURCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c1-13-7-5(3-2-4-10-7)11-6(12-9)8(13)14/h2-4H,9H2,1H3,(H,11,12).
What are the key properties of 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one?
2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one has a molecular weight of 191.19 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-4-methylpyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 71786184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).