C11H15N3O — CID 90706892
2,4-dimethylpyrido[2,3-b]pyrazin-3-one;ethane (PubChem CID 90706892) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,4-dimethylpyrido[2,3-b]pyrazin-3-one;ethane.
| Compound Name | 2,4-dimethylpyrido[2,3-b]pyrazin-3-one;ethane |
|---|---|
| PubChem CID | 90706892 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 2,4-dimethylpyrido[2,3-b]pyrazin-3-one;ethane |
| SMILES | CC.Cc1nc2cccnc2n(C)c1=O |
| InChI | InChI=1S/C9H9N3O.C2H6/c1-6-9(13)12(2)8-7(11-6)4-3-5-10-8;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | SKJACBKKOJXIFC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |