C11H8BrN3S — CID 117164520
2-(5-bromothiophen-2-yl)-3-methylimidazo[4,5-b]pyridine (PubChem CID 117164520) has the molecular formula C11H8BrN3S and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-(5-bromothiophen-2-yl)-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164520 |
| Molecular Formula | C11H8BrN3S |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3-methylimidazo[4,5-b]pyridine |
| SMILES | Cn1c(-c2ccc(Br)s2)nc2cccnc21 |
| InChI | InChI=1S/C11H8BrN3S/c1-15-10-7(3-2-6-13-10)14-11(15)8-4-5-9(12)16-8/h2-6H,1H3 |
| InChIKey | WTVWPJRHCUMULJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |