C16H13N5S2 — CID 10712138
4-amino-5-(3-methylimidazo[4,5-b]pyridin-2-yl)-3-phenyl-1,3-thiazole-2-thione (PubChem CID 10712138) has the molecular formula C16H13N5S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 4-amino-5-(3-methylimidazo[4,5-b]pyridin-2-yl)-3-phenyl-1,3-thiazole-2-thione.
| Compound Name | 4-amino-5-(3-methylimidazo[4,5-b]pyridin-2-yl)-3-phenyl-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 10712138 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 4-amino-5-(3-methylimidazo[4,5-b]pyridin-2-yl)-3-phenyl-1,3-thiazole-2-thione |
| SMILES | Cn1c(-c2sc(=S)n(-c3ccccc3)c2N)nc2cccnc21 |
| InChI | InChI=1S/C16H13N5S2/c1-20-14-11(8-5-9-18-14)19-15(20)12-13(17)21(16(22)23-12)10-6-3-2-4-7-10/h2-9H,17H2,1H3 |
| InChIKey | MFJKQISREGFNTK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|