C59H44N14 — CID 164705835
5-methyl-10-[3-[2,3,5,6-tetrakis(3-methylimidazo[4,5-b]pyridin-2-yl)-4-phenylphenyl]phenyl]phenazine (PubChem CID 164705835) has the molecular formula C59H44N14 and a molecular weight of 949.10 g/mol. Its IUPAC name is 5-methyl-10-[3-[2,3,5,6-tetrakis(3-methylimidazo[4,5-b]pyridin-2-yl)-4-phenylphenyl]phenyl]phenazine.
| Compound Name | 5-methyl-10-[3-[2,3,5,6-tetrakis(3-methylimidazo[4,5-b]pyridin-2-yl)-4-phenylphenyl]phenyl]phenazine |
|---|---|
| PubChem CID | 164705835 |
| Molecular Formula | C59H44N14 |
| Molecular Weight | 949.10 g/mol |
| Exact Mass | 948.39 |
| IUPAC Name | 5-methyl-10-[3-[2,3,5,6-tetrakis(3-methylimidazo[4,5-b]pyridin-2-yl)-4-phenylphenyl]phenyl]phenazine |
| SMILES | CN1c2ccccc2N(c2cccc(-c3c(-c4nc5cccnc5n4C)c(-c4nc5cccnc5n4C)c(-c4ccccc4)c(-c4nc5cccnc5n4C)c3-c3nc4cccnc4n3C)c2)c2ccccc21 |
| InChI | InChI=1S/C59H44N14/c1-68-42-26-9-11-28-44(42)73(45-29-12-10-27-43(45)68)37-21-13-20-36(34-37)47-50(58-66-40-24-16-32-62-54(40)71(58)4)48(56-64-38-22-14-30-60-52(38)69(56)2)46(35-18-7-6-8-19-35)49(57-65-39-23-15-31-61-53(39)70(57)3)51(47)59-67-41-25-17-33-63-55(41)72(59)5/h6-34H,1-5H3 |
| InChIKey | CKEGNHYNJUNITA-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 129.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.10 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |