C11H11N3O — CID 126954775
2-but-2-ynoxy-3-methylimidazo[4,5-b]pyridine (PubChem CID 126954775) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-but-2-ynoxy-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 2-but-2-ynoxy-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 126954775 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-but-2-ynoxy-3-methylimidazo[4,5-b]pyridine |
| SMILES | CC#CCOc1nc2cccnc2n1C |
| InChI | InChI=1S/C11H11N3O/c1-3-4-8-15-11-13-9-6-5-7-12-10(9)14(11)2/h5-7H,8H2,1-2H3 |
| InChIKey | PPIOOKMQKFQTFE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|