C12H15N3O2 — CID 63757796
5-(3-methylimidazo[4,5-b]pyridin-2-yl)pentanoic acid (PubChem CID 63757796) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-(3-methylimidazo[4,5-b]pyridin-2-yl)pentanoic acid.
| Compound Name | 5-(3-methylimidazo[4,5-b]pyridin-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 63757796 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 5-(3-methylimidazo[4,5-b]pyridin-2-yl)pentanoic acid |
| SMILES | Cn1c(CCCCC(=O)O)nc2cccnc21 |
| InChI | InChI=1S/C12H15N3O2/c1-15-10(6-2-3-7-11(16)17)14-9-5-4-8-13-12(9)15/h4-5,8H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | YYQPSBSTIXJZSF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|