C16H15N3O2 — CID 117166780
4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethyl]benzoic acid (PubChem CID 117166780) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethyl]benzoic acid.
| Compound Name | 4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethyl]benzoic acid |
|---|---|
| PubChem CID | 117166780 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-[2-(3-methylimidazo[4,5-b]pyridin-2-yl)ethyl]benzoic acid |
| SMILES | Cn1c(CCc2ccc(C(=O)O)cc2)nc2cccnc21 |
| InChI | InChI=1S/C16H15N3O2/c1-19-14(18-13-3-2-10-17-15(13)19)9-6-11-4-7-12(8-5-11)16(20)21/h2-5,7-8,10H,6,9H2,1H3,(H,20,21) |
| InChIKey | XXKYDQZXPUVTDD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |