C10H8ClN5 — CID 11458952
7-chloro-3-ethyl-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene (PubChem CID 11458952) has the molecular formula C10H8ClN5 and a molecular weight of 233.66 g/mol. Its IUPAC name is 7-chloro-3-ethyl-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene.
| Compound Name | 7-chloro-3-ethyl-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
|---|---|
| PubChem CID | 11458952 |
| Molecular Formula | C10H8ClN5 |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 7-chloro-3-ethyl-2,4,5,8,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaene |
| SMILES | CCc1nnc2c(Cl)nc3cccnc3n12 |
| InChI | InChI=1S/C10H8ClN5/c1-2-7-14-15-10-8(11)13-6-4-3-5-12-9(6)16(7)10/h3-5H,2H2,1H3 |
| InChIKey | VVYAXPFXNAXGTD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |