C15H17N4O+ — CID 123836743
9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one (PubChem CID 123836743) has the molecular formula C15H17N4O+ and a molecular weight of 269.33 g/mol. Its IUPAC name is 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one.
| Compound Name | 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one |
|---|---|
| PubChem CID | 123836743 |
| Molecular Formula | C15H17N4O+ |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one |
| SMILES | O=c1ccn(C2CCCCC2)c2c1cnc1[nH+]c[nH]c12 |
| InChI | InChI=1S/C15H16N4O/c20-12-6-7-19(10-4-2-1-3-5-10)14-11(12)8-16-15-13(14)17-9-18-15/h6-10H,1-5H2,(H,16,17,18)/p+1 |
| InChIKey | CSICGVKNEQMHCS-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 64.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |