About 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one
9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one (PubChem CID 123836743) has the molecular formula C15H17N4O+
and a molecular weight of 269.33 g/mol. Its IUPAC name is 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one.
Molecular Properties
| Compound Name | 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one |
| PubChem CID | 123836743 |
| Molecular Formula | C15H17N4O+ |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one |
| SMILES | O=c1ccn(C2CCCCC2)c2c1cnc1[nH+]c[nH]c12 |
| InChI | InChI=1S/C15H16N4O/c20-12-6-7-19(10-4-2-1-3-5-10)14-11(12)8-16-15-13(14)17-9-18-15/h6-10H,1-5H2,(H,16,17,18)/p+1 |
| InChIKey | CSICGVKNEQMHCS-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 64.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one?
The IUPAC name of 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one (CID 123836743) is 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one.
What is the SMILES notation for 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one?
The canonical SMILES for 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one is O=c1ccn(C2CCCCC2)c2c1cnc1[nH+]c[nH]c12.
What is the InChIKey of 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one?
The InChIKey is CSICGVKNEQMHCS-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H16N4O/c20-12-6-7-19(10-4-2-1-3-5-10)14-11(12)8-16-15-13(14)17-9-18-15/h6-10H,1-5H2,(H,16,17,18)/p+1.
What are the key properties of 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one?
9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one has a molecular weight of 269.33 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclohexyl-1H-imidazo[4,5-h][1,6]naphthyridin-3-ium-6-one is sourced from PubChem (CID 123836743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).