C14H16N2O3 — CID 174750400
(1-cyclopentyl-4-oxo-5H-pyrrolo[3,2-c]pyridin-7-yl) acetate (PubChem CID 174750400) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1-cyclopentyl-4-oxo-5H-pyrrolo[3,2-c]pyridin-7-yl) acetate.
| Compound Name | (1-cyclopentyl-4-oxo-5H-pyrrolo[3,2-c]pyridin-7-yl) acetate |
|---|---|
| PubChem CID | 174750400 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (1-cyclopentyl-4-oxo-5H-pyrrolo[3,2-c]pyridin-7-yl) acetate |
| SMILES | CC(=O)Oc1c[nH]c(=O)c2ccn(C3CCCC3)c12 |
| InChI | InChI=1S/C14H16N2O3/c1-9(17)19-12-8-15-14(18)11-6-7-16(13(11)12)10-4-2-3-5-10/h6-8,10H,2-5H2,1H3,(H,15,18) |
| InChIKey | FQQIPEMDXRQHHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |