C25H32ClN5O3SSi — CID 172721372
13-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-2-yl]-11-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 172721372) has the molecular formula C25H32ClN5O3SSi and a molecular weight of 546.17 g/mol. Its IUPAC name is 13-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-2-yl]-11-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-2-yl]-11-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 172721372 |
| Molecular Formula | C25H32ClN5O3SSi |
| Molecular Weight | 546.17 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 13-[1-[(5-chlorothiophen-2-yl)methyl]piperidin-2-yl]-11-(2-trimethylsilylethoxymethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)c2cnc3[nH]ccc3c2n(C2CCCCN2Cc2ccc(Cl)s2)c1=O |
| InChI | InChI=1S/C25H32ClN5O3SSi/c1-36(2,3)13-12-34-16-30-24(32)19-14-28-23-18(9-10-27-23)22(19)31(25(30)33)21-6-4-5-11-29(21)15-17-7-8-20(26)35-17/h7-10,14,21H,4-6,11-13,15-16H2,1-3H3,(H,27,28) |
| InChIKey | GOEKPXTZHNGOKQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.17 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|