C24H36N6O3Si — CID 90218569
2-[(2-methoxy-3-pyridinyl)amino]-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 90218569) has the molecular formula C24H36N6O3Si and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-[(2-methoxy-3-pyridinyl)amino]-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one.
| Compound Name | 2-[(2-methoxy-3-pyridinyl)amino]-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
|---|---|
| PubChem CID | 90218569 |
| Molecular Formula | C24H36N6O3Si |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 2-[(2-methoxy-3-pyridinyl)amino]-9-[(1S,2R)-2-methylcyclohexyl]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | COc1ncccc1Nc1ncc2c(n1)n([C@H]1CCCC[C@H]1C)c(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H36N6O3Si/c1-17-9-6-7-11-19(17)30-21-20(29(24(30)31)16-33-13-14-34(3,4)5)15-26-23(28-21)27-18-10-8-12-25-22(18)32-2/h8,10,12,15,17,19H,6-7,9,11,13-14,16H2,1-5H3,(H,26,27,28)/t17-,19+/m1/s1 |
| InChIKey | XPJKHIATJJSWSN-MJGOQNOKSA-N |
| XLogP | 4.80 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|