C16H19N7O2 — CID 141352684
2-[(2-methoxy-3-pyridinyl)amino]-9-piperidin-4-yl-7H-purin-8-one (PubChem CID 141352684) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-[(2-methoxy-3-pyridinyl)amino]-9-piperidin-4-yl-7H-purin-8-one.
| Compound Name | 2-[(2-methoxy-3-pyridinyl)amino]-9-piperidin-4-yl-7H-purin-8-one |
|---|---|
| PubChem CID | 141352684 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[(2-methoxy-3-pyridinyl)amino]-9-piperidin-4-yl-7H-purin-8-one |
| SMILES | COc1ncccc1Nc1ncc2[nH]c(=O)n(C3CCNCC3)c2n1 |
| InChI | InChI=1S/C16H19N7O2/c1-25-14-11(3-2-6-18-14)20-15-19-9-12-13(22-15)23(16(24)21-12)10-4-7-17-8-5-10/h2-3,6,9-10,17H,4-5,7-8H2,1H3,(H,21,24)(H,19,20,22) |
| InChIKey | JQNIQEORXRWHMY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |