C21H23N7O — CID 146275593
7-methyl-2-[(7-methylquinolin-6-yl)amino]-9-piperidin-4-ylpurin-8-one (PubChem CID 146275593) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 7-methyl-2-[(7-methylquinolin-6-yl)amino]-9-piperidin-4-ylpurin-8-one.
| Compound Name | 7-methyl-2-[(7-methylquinolin-6-yl)amino]-9-piperidin-4-ylpurin-8-one |
|---|---|
| PubChem CID | 146275593 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 7-methyl-2-[(7-methylquinolin-6-yl)amino]-9-piperidin-4-ylpurin-8-one |
| SMILES | Cc1cc2ncccc2cc1Nc1ncc2c(n1)n(C1CCNCC1)c(=O)n2C |
| InChI | InChI=1S/C21H23N7O/c1-13-10-17-14(4-3-7-23-17)11-16(13)25-20-24-12-18-19(26-20)28(21(29)27(18)2)15-5-8-22-9-6-15/h3-4,7,10-12,15,22H,5-6,8-9H2,1-2H3,(H,24,25,26) |
| InChIKey | BUAYUJMPGUYFPI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |