C46H52N12O4 — CID 159157917
9-(4-hydroxy-4-methylcyclohexyl)-7-methyl-2-[(7-methylquinolin-6-yl)amino]purin-8-one (PubChem CID 159157917) has the molecular formula C46H52N12O4 and a molecular weight of 837.00 g/mol. Its IUPAC name is 9-(4-hydroxy-4-methylcyclohexyl)-7-methyl-2-[(7-methylquinolin-6-yl)amino]purin-8-one.
| Compound Name | 9-(4-hydroxy-4-methylcyclohexyl)-7-methyl-2-[(7-methylquinolin-6-yl)amino]purin-8-one |
|---|---|
| PubChem CID | 159157917 |
| Molecular Formula | C46H52N12O4 |
| Molecular Weight | 837.00 g/mol |
| Exact Mass | 836.42 |
| IUPAC Name | 9-(4-hydroxy-4-methylcyclohexyl)-7-methyl-2-[(7-methylquinolin-6-yl)amino]purin-8-one |
| SMILES | Cc1cc2ncccc2cc1Nc1ncc2c(n1)n(C1CCC(C)(O)CC1)c(=O)n2C.Cc1cc2ncccc2cc1Nc1ncc2c(n1)n(C1CCC(C)(O)CC1)c(=O)n2C |
| InChI | InChI=1S/2C23H26N6O2/c2*1-14-11-18-15(5-4-10-24-18)12-17(14)26-21-25-13-19-20(27-21)29(22(30)28(19)3)16-6-8-23(2,31)9-7-16/h2*4-5,10-13,16,31H,6-9H2,1-3H3,(H,25,26,27) |
| InChIKey | KKCVXHLLBRAETM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 195.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.00 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |