C19H22N6O4 — CID 156889796
2-hydroxy-5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzamide (PubChem CID 156889796) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-hydroxy-5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzamide.
| Compound Name | 2-hydroxy-5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 156889796 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-hydroxy-5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzamide |
| SMILES | Cc1cc(C(N)=O)c(O)cc1Nc1ncc2c(n1)n(C1CCOCC1)c(=O)n2C |
| InChI | InChI=1S/C19H22N6O4/c1-10-7-12(16(20)27)15(26)8-13(10)22-18-21-9-14-17(23-18)25(19(28)24(14)2)11-3-5-29-6-4-11/h7-9,11,26H,3-6H2,1-2H3,(H2,20,27)(H,21,22,23) |
| InChIKey | VLQLEOYWVVFSTM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |