C21H27FN6O2S — CID 176918940
2-fluoro-5-methyl-4-[[7-methyl-8-oxo-9-(thiolan-3-yl)purin-2-yl]amino]benzamide;propane (PubChem CID 176918940) has the molecular formula C21H27FN6O2S and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-fluoro-5-methyl-4-[[7-methyl-8-oxo-9-(thiolan-3-yl)purin-2-yl]amino]benzamide;propane.
| Compound Name | 2-fluoro-5-methyl-4-[[7-methyl-8-oxo-9-(thiolan-3-yl)purin-2-yl]amino]benzamide;propane |
|---|---|
| PubChem CID | 176918940 |
| Molecular Formula | C21H27FN6O2S |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-fluoro-5-methyl-4-[[7-methyl-8-oxo-9-(thiolan-3-yl)purin-2-yl]amino]benzamide;propane |
| SMILES | CCC.Cc1cc(C(N)=O)c(F)cc1Nc1ncc2c(n1)n(C1CCSC1)c(=O)n2C |
| InChI | InChI=1S/C18H19FN6O2S.C3H8/c1-9-5-11(15(20)26)12(19)6-13(9)22-17-21-7-14-16(23-17)25(18(27)24(14)2)10-3-4-28-8-10;1-3-2/h5-7,10H,3-4,8H2,1-2H3,(H2,20,26)(H,21,22,23);3H2,1-2H3 |
| InChIKey | UXXXARTVTXYWJJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |