C21H27FN6O3 — CID 178015286
cyclohexanol;4-[(7,9-dimethyl-8-oxopurin-2-yl)amino]-2-fluoro-5-methylbenzamide (PubChem CID 178015286) has the molecular formula C21H27FN6O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is cyclohexanol;4-[(7,9-dimethyl-8-oxopurin-2-yl)amino]-2-fluoro-5-methylbenzamide.
| Compound Name | cyclohexanol;4-[(7,9-dimethyl-8-oxopurin-2-yl)amino]-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 178015286 |
| Molecular Formula | C21H27FN6O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | cyclohexanol;4-[(7,9-dimethyl-8-oxopurin-2-yl)amino]-2-fluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc2c(n1)n(C)c(=O)n2C.OC1CCCCC1 |
| InChI | InChI=1S/C15H15FN6O2.C6H12O/c1-7-4-8(12(17)23)9(16)5-10(7)19-14-18-6-11-13(20-14)22(3)15(24)21(11)2;7-6-4-2-1-3-5-6/h4-6H,1-3H3,(H2,17,23)(H,18,19,20);6-7H,1-5H2 |
| InChIKey | YMFQJUTVNURFCT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |