C21H23FN6O3 — CID 156889771
4-[[9-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-7-methyl-8-oxopurin-2-yl]amino]-2-fluoro-5-methylbenzamide (PubChem CID 156889771) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is 4-[[9-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-7-methyl-8-oxopurin-2-yl]amino]-2-fluoro-5-methylbenzamide.
| Compound Name | 4-[[9-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-7-methyl-8-oxopurin-2-yl]amino]-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 156889771 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-[[9-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-7-methyl-8-oxopurin-2-yl]amino]-2-fluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc2c(n1)n(C1C[C@@H]3COC[C@H]3C1)c(=O)n2C |
| InChI | InChI=1S/C21H23FN6O3/c1-10-3-14(18(23)29)15(22)6-16(10)25-20-24-7-17-19(26-20)28(21(30)27(17)2)13-4-11-8-31-9-12(11)5-13/h3,6-7,11-13H,4-5,8-9H2,1-2H3,(H2,23,29)(H,24,25,26)/t11-,12-/m1/s1 |
| InChIKey | SSEHMUCSLZLPAB-VXGBXAGGSA-N |
| XLogP | 2.02 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |