C19H23FN6O2 — CID 177344173
4-[[7-ethyl-8-(oxan-4-yl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]-2-fluoro-5-methylbenzamide (PubChem CID 177344173) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 4-[[7-ethyl-8-(oxan-4-yl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]-2-fluoro-5-methylbenzamide.
| Compound Name | 4-[[7-ethyl-8-(oxan-4-yl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 177344173 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[[7-ethyl-8-(oxan-4-yl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]-2-fluoro-5-methylbenzamide |
| SMILES | CCn1c2cnc(Nc3cc(F)c(C(N)=O)cc3C)nc2n1C1CCOCC1 |
| InChI | InChI=1S/C19H23FN6O2/c1-3-25-16-10-22-19(24-18(16)26(25)12-4-6-28-7-5-12)23-15-9-14(20)13(17(21)27)8-11(15)2/h8-10,12H,3-7H2,1-2H3,(H2,21,27)(H,22,23,24) |
| InChIKey | BPIZMRSKJXGGOW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |