C15H18FN5O — CID 178120166
4-[[5-(dimethylamino)-4-methylpyrimidin-2-yl]amino]-2-fluoro-5-methylbenzamide (PubChem CID 178120166) has the molecular formula C15H18FN5O and a molecular weight of 303.34 g/mol. Its IUPAC name is 4-[[5-(dimethylamino)-4-methylpyrimidin-2-yl]amino]-2-fluoro-5-methylbenzamide.
| Compound Name | 4-[[5-(dimethylamino)-4-methylpyrimidin-2-yl]amino]-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 178120166 |
| Molecular Formula | C15H18FN5O |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-[[5-(dimethylamino)-4-methylpyrimidin-2-yl]amino]-2-fluoro-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc(N(C)C)c(C)n1 |
| InChI | InChI=1S/C15H18FN5O/c1-8-5-10(14(17)22)11(16)6-12(8)20-15-18-7-13(21(3)4)9(2)19-15/h5-7H,1-4H3,(H2,17,22)(H,18,19,20) |
| InChIKey | IVISLOILAMBDFY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |