C22H25BFN5O3 — CID 178120173
CID 178120173 (PubChem CID 178120173) has the molecular formula C22H25BFN5O3 and a molecular weight of 437.28 g/mol.
| Compound Name | CID 178120173 |
|---|---|
| PubChem CID | 178120173 |
| Molecular Formula | C22H25BFN5O3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | — |
| SMILES | [B]C(=O)c1cc(C)c(Nc2ncc(N(C)C)c(N(C=O)C3CC4(CC(O)C4)C3)n2)cc1F |
| InChI | InChI=1S/C22H25BFN5O3/c1-12-4-15(19(23)32)16(24)5-17(12)26-21-25-10-18(28(2)3)20(27-21)29(11-30)13-6-22(7-13)8-14(31)9-22/h4-5,10-11,13-14,31H,6-9H2,1-3H3,(H,25,26,27) |
| InChIKey | DGIUZTNXKFGPFZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|