C22H25FN6O3 — CID 166802523
2-fluoro-4-[[9-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-7-methyl-8-oxopurin-2-yl]amino]-5-methylbenzamide (PubChem CID 166802523) has the molecular formula C22H25FN6O3 and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-fluoro-4-[[9-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-7-methyl-8-oxopurin-2-yl]amino]-5-methylbenzamide.
| Compound Name | 2-fluoro-4-[[9-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-7-methyl-8-oxopurin-2-yl]amino]-5-methylbenzamide |
|---|---|
| PubChem CID | 166802523 |
| Molecular Formula | C22H25FN6O3 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-fluoro-4-[[9-(5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-7-methyl-8-oxopurin-2-yl]amino]-5-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc2c(n1)n(C1CC3CC(O)CC3C1)c(=O)n2C |
| InChI | InChI=1S/C22H25FN6O3/c1-10-3-15(19(24)31)16(23)8-17(10)26-21-25-9-18-20(27-21)29(22(32)28(18)2)13-4-11-6-14(30)7-12(11)5-13/h3,8-9,11-14,30H,4-7H2,1-2H3,(H2,24,31)(H,25,26,27) |
| InChIKey | FQUZHYIMYJBQAY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |