C19H21FN6O3 — CID 166802275
4-[[7-ethyl-8-oxo-9-(oxolan-3-yl)purin-2-yl]amino]-2-fluoro-5-methylbenzamide (PubChem CID 166802275) has the molecular formula C19H21FN6O3 and a molecular weight of 400.41 g/mol. Its IUPAC name is 4-[[7-ethyl-8-oxo-9-(oxolan-3-yl)purin-2-yl]amino]-2-fluoro-5-methylbenzamide.
| Compound Name | 4-[[7-ethyl-8-oxo-9-(oxolan-3-yl)purin-2-yl]amino]-2-fluoro-5-methylbenzamide |
|---|---|
| PubChem CID | 166802275 |
| Molecular Formula | C19H21FN6O3 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[[7-ethyl-8-oxo-9-(oxolan-3-yl)purin-2-yl]amino]-2-fluoro-5-methylbenzamide |
| SMILES | CCn1c(=O)n(C2CCOC2)c2nc(Nc3cc(F)c(C(N)=O)cc3C)ncc21 |
| InChI | InChI=1S/C19H21FN6O3/c1-3-25-15-8-22-18(23-14-7-13(20)12(16(21)27)6-10(14)2)24-17(15)26(19(25)28)11-4-5-29-9-11/h6-8,11H,3-5,9H2,1-2H3,(H2,21,27)(H,22,23,24) |
| InChIKey | RWUZMIYBDLLRPC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |