C20H21N7O2 — CID 146275575
7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9-(oxan-3-yl)purin-8-one (PubChem CID 146275575) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9-(oxan-3-yl)purin-8-one.
| Compound Name | 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9-(oxan-3-yl)purin-8-one |
|---|---|
| PubChem CID | 146275575 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9-(oxan-3-yl)purin-8-one |
| SMILES | Cc1cc2nnccc2cc1Nc1ncc2c(n1)n(C1CCCOC1)c(=O)n2C |
| InChI | InChI=1S/C20H21N7O2/c1-12-8-16-13(5-6-22-25-16)9-15(12)23-19-21-10-17-18(24-19)27(20(28)26(17)2)14-4-3-7-29-11-14/h5-6,8-10,14H,3-4,7,11H2,1-2H3,(H,21,23,24) |
| InChIKey | MUSBPXCQBAUPOW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |