C15H13N7O — CID 156654187
7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9H-purin-8-one (PubChem CID 156654187) has the molecular formula C15H13N7O and a molecular weight of 307.32 g/mol. Its IUPAC name is 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9H-purin-8-one.
| Compound Name | 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9H-purin-8-one |
|---|---|
| PubChem CID | 156654187 |
| Molecular Formula | C15H13N7O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 7-methyl-2-[(7-methylcinnolin-6-yl)amino]-9H-purin-8-one |
| SMILES | Cc1cc2nnccc2cc1Nc1ncc2c(n1)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H13N7O/c1-8-5-11-9(3-4-17-21-11)6-10(8)18-14-16-7-12-13(19-14)20-15(23)22(12)2/h3-7H,1-2H3,(H2,16,18,19,20,23) |
| InChIKey | FDMPCFXWMFILOA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |