About 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one
2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one (PubChem CID 156572682) has the molecular formula C14H12ClN5O2
and a molecular weight of 317.74 g/mol. Its IUPAC name is 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one.
Molecular Properties
| Compound Name | 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one |
| PubChem CID | 156572682 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one |
| SMILES | Cn1c(=O)[nH]c2nc(Nc3cc4c(cc3Cl)OCC4)ncc21 |
| InChI | InChI=1S/C14H12ClN5O2/c1-20-10-6-16-13(18-12(10)19-14(20)21)17-9-4-7-2-3-22-11(7)5-8(9)15/h4-6H,2-3H2,1H3,(H2,16,17,18,19,21) |
| InChIKey | NMESKQZHGLCVJW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one?
The IUPAC name of 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one (CID 156572682) is 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one.
What is the SMILES notation for 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one?
The canonical SMILES for 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one is Cn1c(=O)[nH]c2nc(Nc3cc4c(cc3Cl)OCC4)ncc21.
What is the InChIKey of 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one?
The InChIKey is NMESKQZHGLCVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN5O2/c1-20-10-6-16-13(18-12(10)19-14(20)21)17-9-4-7-2-3-22-11(7)5-8(9)15/h4-6H,2-3H2,1H3,(H2,16,17,18,19,21).
What are the key properties of 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one?
2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one has a molecular weight of 317.74 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-2,3-dihydro-1-benzofuran-5-yl)amino]-7-methyl-9H-purin-8-one is sourced from PubChem (CID 156572682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).