C37H43N5O4Si — CID 156776406
9-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]-7-methyl-2-[(6-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]purin-8-one (PubChem CID 156776406) has the molecular formula C37H43N5O4Si and a molecular weight of 649.87 g/mol. Its IUPAC name is 9-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]-7-methyl-2-[(6-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]purin-8-one.
| Compound Name | 9-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]-7-methyl-2-[(6-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]purin-8-one |
|---|---|
| PubChem CID | 156776406 |
| Molecular Formula | C37H43N5O4Si |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.31 |
| IUPAC Name | 9-[6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-3-yl]-7-methyl-2-[(6-methyl-2,3-dihydro-1-benzofuran-5-yl)amino]purin-8-one |
| SMILES | Cc1cc2c(cc1Nc1ncc3c(n1)n(C1CCC(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)OC1)c(=O)n3C)CCO2 |
| InChI | InChI=1S/C37H43N5O4Si/c1-25-20-33-26(18-19-44-33)21-31(25)39-35-38-22-32-34(40-35)42(36(43)41(32)5)27-16-17-28(45-23-27)24-46-47(37(2,3)4,29-12-8-6-9-13-29)30-14-10-7-11-15-30/h6-15,20-22,27-28H,16-19,23-24H2,1-5H3,(H,38,39,40) |
| InChIKey | VIJWAPIBLSHLOG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|