C17H20N6O3 — CID 168776530
2-[(6-deuteriooxy-4-methyl-3-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one (PubChem CID 168776530) has the molecular formula C17H20N6O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is 2-[(6-deuteriooxy-4-methyl-3-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one.
| Compound Name | 2-[(6-deuteriooxy-4-methyl-3-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one |
|---|---|
| PubChem CID | 168776530 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[(6-deuteriooxy-4-methyl-3-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one |
| SMILES | [2H]Oc1cc(C)c(Nc2ncc3c(n2)n(C2CCOCC2)c(=O)n3C)cn1 |
| InChI | InChI=1S/C17H20N6O3/c1-10-7-14(24)18-8-12(10)20-16-19-9-13-15(21-16)23(17(25)22(13)2)11-3-5-26-6-4-11/h7-9,11H,3-6H2,1-2H3,(H,18,24)(H,19,20,21)/i/hD |
| InChIKey | DOSADYGSRDMCSO-DYCDLGHISA-N |
| XLogP | 1.63 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |