C18H19N7OS2 — CID 164903224
7-methyl-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]-9-(oxan-4-yl)purine-8-thione (PubChem CID 164903224) has the molecular formula C18H19N7OS2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 7-methyl-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]-9-(oxan-4-yl)purine-8-thione.
| Compound Name | 7-methyl-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]-9-(oxan-4-yl)purine-8-thione |
|---|---|
| PubChem CID | 164903224 |
| Molecular Formula | C18H19N7OS2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 7-methyl-2-[(6-methyl-2,1,3-benzothiadiazol-5-yl)amino]-9-(oxan-4-yl)purine-8-thione |
| SMILES | Cc1cc2nsnc2cc1Nc1ncc2c(n1)n(C1CCOCC1)c(=S)n2C |
| InChI | InChI=1S/C18H19N7OS2/c1-10-7-13-14(23-28-22-13)8-12(10)20-17-19-9-15-16(21-17)25(18(27)24(15)2)11-3-5-26-6-4-11/h7-9,11H,3-6H2,1-2H3,(H,19,20,21) |
| InChIKey | VRSOQOXWTONCIF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|