C19H20N6OS — CID 175603761
3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-sulfanylidenepurin-2-yl]amino]benzonitrile (PubChem CID 175603761) has the molecular formula C19H20N6OS and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-sulfanylidenepurin-2-yl]amino]benzonitrile.
| Compound Name | 3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-sulfanylidenepurin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 175603761 |
| Molecular Formula | C19H20N6OS |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-sulfanylidenepurin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1Nc1ncc2c(n1)n(C1CCOCC1)c(=S)n2C |
| InChI | InChI=1S/C19H20N6OS/c1-12-9-13(10-20)3-4-15(12)22-18-21-11-16-17(23-18)25(19(27)24(16)2)14-5-7-26-8-6-14/h3-4,9,11,14H,5-8H2,1-2H3,(H,21,22,23) |
| InChIKey | KUTBBFOXPGJLJI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 80.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|