C18H24N8O2 — CID 177365111
N'-[4-methyl-5-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-2-pyridinyl]methanimidamide;molecular hydrogen (PubChem CID 177365111) has the molecular formula C18H24N8O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is N'-[4-methyl-5-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-2-pyridinyl]methanimidamide;molecular hydrogen.
| Compound Name | N'-[4-methyl-5-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-2-pyridinyl]methanimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 177365111 |
| Molecular Formula | C18H24N8O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-[4-methyl-5-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]-2-pyridinyl]methanimidamide;molecular hydrogen |
| SMILES | Cc1cc(/N=C/N)ncc1Nc1ncc2c(n1)n(C1CCOCC1)c(=O)n2C.[H][H] |
| InChI | InChI=1S/C18H22N8O2.H2/c1-11-7-15(22-10-19)20-8-13(11)23-17-21-9-14-16(24-17)26(18(27)25(14)2)12-3-5-28-6-4-12;/h7-10,12H,3-6H2,1-2H3,(H2,19,20,22)(H,21,23,24);1H |
| InChIKey | RRJHBAYPVPAEKF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|