C21H25FN6O3 — CID 156889700
2-fluoro-5-methyl-4-[[9-(oxan-4-yl)-8-oxo-7-propan-2-ylpurin-2-yl]amino]benzamide (PubChem CID 156889700) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-fluoro-5-methyl-4-[[9-(oxan-4-yl)-8-oxo-7-propan-2-ylpurin-2-yl]amino]benzamide.
| Compound Name | 2-fluoro-5-methyl-4-[[9-(oxan-4-yl)-8-oxo-7-propan-2-ylpurin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 156889700 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-fluoro-5-methyl-4-[[9-(oxan-4-yl)-8-oxo-7-propan-2-ylpurin-2-yl]amino]benzamide |
| SMILES | Cc1cc(C(N)=O)c(F)cc1Nc1ncc2c(n1)n(C1CCOCC1)c(=O)n2C(C)C |
| InChI | InChI=1S/C21H25FN6O3/c1-11(2)27-17-10-24-20(25-16-9-15(22)14(18(23)29)8-12(16)3)26-19(17)28(21(27)30)13-4-6-31-7-5-13/h8-11,13H,4-7H2,1-3H3,(H2,23,29)(H,24,25,26) |
| InChIKey | XDRJWRYUFKMWBR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |