C17H20N6O3S — CID 156889706
5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]thiophene-2-carboxamide (PubChem CID 156889706) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]thiophene-2-carboxamide.
| Compound Name | 5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 156889706 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 5-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]thiophene-2-carboxamide |
| SMILES | Cc1sc(C(N)=O)cc1Nc1ncc2c(n1)n(C1CCOCC1)c(=O)n2C |
| InChI | InChI=1S/C17H20N6O3S/c1-9-11(7-13(27-9)14(18)24)20-16-19-8-12-15(21-16)23(17(25)22(12)2)10-3-5-26-6-4-10/h7-8,10H,3-6H2,1-2H3,(H2,18,24)(H,19,20,21) |
| InChIKey | BMKIWSABSPBICR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |