C18H22N6O3 — CID 156889807
2-[(5-methoxy-3-methyl-2-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one (PubChem CID 156889807) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[(5-methoxy-3-methyl-2-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one.
| Compound Name | 2-[(5-methoxy-3-methyl-2-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one |
|---|---|
| PubChem CID | 156889807 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[(5-methoxy-3-methyl-2-pyridinyl)amino]-7-methyl-9-(oxan-4-yl)purin-8-one |
| SMILES | COc1cnc(Nc2ncc3c(n2)n(C2CCOCC2)c(=O)n3C)c(C)c1 |
| InChI | InChI=1S/C18H22N6O3/c1-11-8-13(26-3)9-19-15(11)21-17-20-10-14-16(22-17)24(18(25)23(14)2)12-4-6-27-7-5-12/h8-10,12H,4-7H2,1-3H3,(H,19,20,21,22) |
| InChIKey | IIEYYRBLJOXTJH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |