C19H19FN6O2 — CID 156889767
2-fluoro-3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzonitrile (PubChem CID 156889767) has the molecular formula C19H19FN6O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-fluoro-3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzonitrile.
| Compound Name | 2-fluoro-3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 156889767 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-fluoro-3-methyl-4-[[7-methyl-9-(oxan-4-yl)-8-oxopurin-2-yl]amino]benzonitrile |
| SMILES | Cc1c(Nc2ncc3c(n2)n(C2CCOCC2)c(=O)n3C)ccc(C#N)c1F |
| InChI | InChI=1S/C19H19FN6O2/c1-11-14(4-3-12(9-21)16(11)20)23-18-22-10-15-17(24-18)26(19(27)25(15)2)13-5-7-28-8-6-13/h3-4,10,13H,5-8H2,1-2H3,(H,22,23,24) |
| InChIKey | WOFACWYODZJSHO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |