C21H21N7O — CID 175712462
2-[[9-(4-cyanocyclohexyl)-7-methyl-8-oxopurin-2-yl]amino]-3-methylbenzonitrile (PubChem CID 175712462) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-[[9-(4-cyanocyclohexyl)-7-methyl-8-oxopurin-2-yl]amino]-3-methylbenzonitrile.
| Compound Name | 2-[[9-(4-cyanocyclohexyl)-7-methyl-8-oxopurin-2-yl]amino]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 175712462 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[[9-(4-cyanocyclohexyl)-7-methyl-8-oxopurin-2-yl]amino]-3-methylbenzonitrile |
| SMILES | Cc1cccc(C#N)c1Nc1ncc2c(n1)n(C1CCC(C#N)CC1)c(=O)n2C |
| InChI | InChI=1S/C21H21N7O/c1-13-4-3-5-15(11-23)18(13)25-20-24-12-17-19(26-20)28(21(29)27(17)2)16-8-6-14(10-22)7-9-16/h3-5,12,14,16H,6-9H2,1-2H3,(H,24,25,26) |
| InChIKey | PIIOXLHWRCDNQU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |