C20H25F2N5OS — CID 176918891
2-(4,5-difluoro-2-methylanilino)-7-methyl-9-(thiolan-3-yl)purin-8-one;propane (PubChem CID 176918891) has the molecular formula C20H25F2N5OS and a molecular weight of 421.52 g/mol. Its IUPAC name is 2-(4,5-difluoro-2-methylanilino)-7-methyl-9-(thiolan-3-yl)purin-8-one;propane.
| Compound Name | 2-(4,5-difluoro-2-methylanilino)-7-methyl-9-(thiolan-3-yl)purin-8-one;propane |
|---|---|
| PubChem CID | 176918891 |
| Molecular Formula | C20H25F2N5OS |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-(4,5-difluoro-2-methylanilino)-7-methyl-9-(thiolan-3-yl)purin-8-one;propane |
| SMILES | CCC.Cc1cc(F)c(F)cc1Nc1ncc2c(n1)n(C1CCSC1)c(=O)n2C |
| InChI | InChI=1S/C17H17F2N5OS.C3H8/c1-9-5-11(18)12(19)6-13(9)21-16-20-7-14-15(22-16)24(17(25)23(14)2)10-3-4-26-8-10;1-3-2/h5-7,10H,3-4,8H2,1-2H3,(H,20,21,22);3H2,1-2H3 |
| InChIKey | XZPDVXMULPUDNC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |