C24H24F2N6O — CID 175591484
3-(4,4-difluorocyclohexyl)-6-[(7-methylquinolin-6-yl)amino]-1,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 175591484) has the molecular formula C24H24F2N6O and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-(4,4-difluorocyclohexyl)-6-[(7-methylquinolin-6-yl)amino]-1,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 3-(4,4-difluorocyclohexyl)-6-[(7-methylquinolin-6-yl)amino]-1,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 175591484 |
| Molecular Formula | C24H24F2N6O |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-(4,4-difluorocyclohexyl)-6-[(7-methylquinolin-6-yl)amino]-1,3,5,7-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | Cc1cc2ncccc2cc1Nc1nc2c3c(n1)n(C1CCC(F)(F)CC1)c(=O)n3CCC2 |
| InChI | InChI=1S/C24H24F2N6O/c1-14-12-19-15(4-2-10-27-19)13-18(14)29-22-28-17-5-3-11-31-20(17)21(30-22)32(23(31)33)16-6-8-24(25,26)9-7-16/h2,4,10,12-13,16H,3,5-9,11H2,1H3,(H,28,29,30) |
| InChIKey | RFVIFBSUQWHGNM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |