C21H21F2N5O4 — CID 164903227
8-(4,4-difluorocyclohexyl)-5-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]pteridine-6,7-dione (PubChem CID 164903227) has the molecular formula C21H21F2N5O4 and a molecular weight of 445.43 g/mol. Its IUPAC name is 8-(4,4-difluorocyclohexyl)-5-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]pteridine-6,7-dione.
| Compound Name | 8-(4,4-difluorocyclohexyl)-5-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]pteridine-6,7-dione |
|---|---|
| PubChem CID | 164903227 |
| Molecular Formula | C21H21F2N5O4 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 8-(4,4-difluorocyclohexyl)-5-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]pteridine-6,7-dione |
| SMILES | Cc1cc2c(cc1Nc1ncc3c(n1)n(C1CCC(F)(F)CC1)c(=O)c(=O)n3C)OCO2 |
| InChI | InChI=1S/C21H21F2N5O4/c1-11-7-15-16(32-10-31-15)8-13(11)25-20-24-9-14-17(26-20)28(19(30)18(29)27(14)2)12-3-5-21(22,23)6-4-12/h7-9,12H,3-6,10H2,1-2H3,(H,24,25,26) |
| InChIKey | ABTRRKITFDAQKC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|