C19H18N6O3 — CID 176919084
2-methylidene-4-[7-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]-8-oxopurin-9-yl]butanenitrile (PubChem CID 176919084) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is 2-methylidene-4-[7-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]-8-oxopurin-9-yl]butanenitrile.
| Compound Name | 2-methylidene-4-[7-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]-8-oxopurin-9-yl]butanenitrile |
|---|---|
| PubChem CID | 176919084 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2-methylidene-4-[7-methyl-2-[(6-methyl-1,3-benzodioxol-5-yl)amino]-8-oxopurin-9-yl]butanenitrile |
| SMILES | C=C(C#N)CCn1c(=O)n(C)c2cnc(Nc3cc4c(cc3C)OCO4)nc21 |
| InChI | InChI=1S/C19H18N6O3/c1-11(8-20)4-5-25-17-14(24(3)19(25)26)9-21-18(23-17)22-13-7-16-15(6-12(13)2)27-10-28-16/h6-7,9H,1,4-5,10H2,2-3H3,(H,21,22,23) |
| InChIKey | PKMAGCCKCLGTFA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|