C12H16N6O2 — CID 154640809
8-cyclopentyl-2-hydrazinyl-5-methylpteridine-6,7-dione (PubChem CID 154640809) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 8-cyclopentyl-2-hydrazinyl-5-methylpteridine-6,7-dione.
| Compound Name | 8-cyclopentyl-2-hydrazinyl-5-methylpteridine-6,7-dione |
|---|---|
| PubChem CID | 154640809 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 8-cyclopentyl-2-hydrazinyl-5-methylpteridine-6,7-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCCC2)c2nc(NN)ncc21 |
| InChI | InChI=1S/C12H16N6O2/c1-17-8-6-14-12(16-13)15-9(8)18(11(20)10(17)19)7-4-2-3-5-7/h6-7H,2-5,13H2,1H3,(H,14,15,16) |
| InChIKey | XSKMAMLHHJPZPF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|