C19H18ClFN6O2 — CID 154640813
2-[2-[(2-chloro-4-fluorophenyl)methylidene]hydrazinyl]-8-cyclopentyl-5-methylpteridine-6,7-dione (PubChem CID 154640813) has the molecular formula C19H18ClFN6O2 and a molecular weight of 416.84 g/mol. Its IUPAC name is 2-[2-[(2-chloro-4-fluorophenyl)methylidene]hydrazinyl]-8-cyclopentyl-5-methylpteridine-6,7-dione.
| Compound Name | 2-[2-[(2-chloro-4-fluorophenyl)methylidene]hydrazinyl]-8-cyclopentyl-5-methylpteridine-6,7-dione |
|---|---|
| PubChem CID | 154640813 |
| Molecular Formula | C19H18ClFN6O2 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[2-[(2-chloro-4-fluorophenyl)methylidene]hydrazinyl]-8-cyclopentyl-5-methylpteridine-6,7-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCCC2)c2nc(NN=Cc3ccc(F)cc3Cl)ncc21 |
| InChI | InChI=1S/C19H18ClFN6O2/c1-26-15-10-22-19(25-23-9-11-6-7-12(21)8-14(11)20)24-16(15)27(18(29)17(26)28)13-4-2-3-5-13/h6-10,13H,2-5H2,1H3,(H,22,24,25) |
| InChIKey | OBUOIQUTNFKKQB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|